C16H31F3N2 — CID 60856481
N-[[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]methyl]nonan-2-amine (PubChem CID 60856481) has the molecular formula C16H31F3N2 and a molecular weight of 308.43 g/mol. Its IUPAC name is N-[[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]methyl]nonan-2-amine.
| Compound Name | N-[[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]methyl]nonan-2-amine |
|---|---|
| PubChem CID | 60856481 |
| Molecular Formula | C16H31F3N2 |
| Molecular Weight | 308.43 g/mol |
| Exact Mass | 308.24 |
| IUPAC Name | N-[[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]methyl]nonan-2-amine |
| SMILES | CCCCCCCC(C)NCC1CCN(CC(F)(F)F)C1 |
| InChI | InChI=1S/C16H31F3N2/c1-3-4-5-6-7-8-14(2)20-11-15-9-10-21(12-15)13-16(17,18)19/h14-15,20H,3-13H2,1-2H3 |
| InChIKey | MBMMWUBIYXIZEA-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.43 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|