C11H20N4O2S — CID 60857032
N'-(2-amino-2-sulfanylideneethyl)-N-[(1-ethylpyrrolidin-3-yl)methyl]oxamide (PubChem CID 60857032) has the molecular formula C11H20N4O2S and a molecular weight of 272.37 g/mol. Its IUPAC name is N'-(2-amino-2-sulfanylideneethyl)-N-[(1-ethylpyrrolidin-3-yl)methyl]oxamide.
| Compound Name | N'-(2-amino-2-sulfanylideneethyl)-N-[(1-ethylpyrrolidin-3-yl)methyl]oxamide |
|---|---|
| PubChem CID | 60857032 |
| Molecular Formula | C11H20N4O2S |
| Molecular Weight | 272.37 g/mol |
| Exact Mass | 272.13 |
| IUPAC Name | N'-(2-amino-2-sulfanylideneethyl)-N-[(1-ethylpyrrolidin-3-yl)methyl]oxamide |
| SMILES | CCN1CCC(CNC(=O)C(=O)NCC(N)=S)C1 |
| InChI | InChI=1S/C11H20N4O2S/c1-2-15-4-3-8(7-15)5-13-10(16)11(17)14-6-9(12)18/h8H,2-7H2,1H3,(H2,12,18)(H,13,16)(H,14,17) |
| InChIKey | VMVOGFAIBUQSJX-UHFFFAOYSA-N |
| XLogP | -1.15 |
| TPSA | 87.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.37 |
| LogP ≤ 5 | -1.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|