C13H21N3O3S — CID 60857223
3-amino-4-methoxy-N-[(1-methylpyrrolidin-3-yl)methyl]benzenesulfonamide (PubChem CID 60857223) has the molecular formula C13H21N3O3S and a molecular weight of 299.40 g/mol. Its IUPAC name is 3-amino-4-methoxy-N-[(1-methylpyrrolidin-3-yl)methyl]benzenesulfonamide.
| Compound Name | 3-amino-4-methoxy-N-[(1-methylpyrrolidin-3-yl)methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 60857223 |
| Molecular Formula | C13H21N3O3S |
| Molecular Weight | 299.40 g/mol |
| Exact Mass | 299.13 |
| IUPAC Name | 3-amino-4-methoxy-N-[(1-methylpyrrolidin-3-yl)methyl]benzenesulfonamide |
| SMILES | COc1ccc(S(=O)(=O)NCC2CCN(C)C2)cc1N |
| InChI | InChI=1S/C13H21N3O3S/c1-16-6-5-10(9-16)8-15-20(17,18)11-3-4-13(19-2)12(14)7-11/h3-4,7,10,15H,5-6,8-9,14H2,1-2H3 |
| InChIKey | BGDHPAYDDHZMNK-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.40 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|