C22H22N2O4 — CID 6085751
3-[5-[(E)-2-cyano-3-(cyclohexylamino)-3-oxoprop-1-enyl]furan-2-yl]-2-methylbenzoic acid (PubChem CID 6085751) has the molecular formula C22H22N2O4 and a molecular weight of 378.43 g/mol. Its IUPAC name is 3-[5-[(E)-2-cyano-3-(cyclohexylamino)-3-oxoprop-1-enyl]furan-2-yl]-2-methylbenzoic acid.
| Compound Name | 3-[5-[(E)-2-cyano-3-(cyclohexylamino)-3-oxoprop-1-enyl]furan-2-yl]-2-methylbenzoic acid |
|---|---|
| PubChem CID | 6085751 |
| Molecular Formula | C22H22N2O4 |
| Molecular Weight | 378.43 g/mol |
| Exact Mass | 378.16 |
| IUPAC Name | 3-[5-[(E)-2-cyano-3-(cyclohexylamino)-3-oxoprop-1-enyl]furan-2-yl]-2-methylbenzoic acid |
| SMILES | Cc1c(C(=O)O)cccc1-c1ccc(/C=C(\C#N)C(=O)NC2CCCCC2)o1 |
| InChI | InChI=1S/C22H22N2O4/c1-14-18(8-5-9-19(14)22(26)27)20-11-10-17(28-20)12-15(13-23)21(25)24-16-6-3-2-4-7-16/h5,8-12,16H,2-4,6-7H2,1H3,(H,24,25)(H,26,27)/b15-12+ |
| InChIKey | NCNVZSIWQNKSHB-NTCAYCPXSA-N |
| XLogP | 4.31 |
| TPSA | 103.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.43 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|