C12H14Cl2N2O4S — CID 60857772
1-[(2,6-dichlorophenyl)sulfamoyl]piperidine-3-carboxylic acid (PubChem CID 60857772) has the molecular formula C12H14Cl2N2O4S and a molecular weight of 353.23 g/mol. Its IUPAC name is 1-[(2,6-dichlorophenyl)sulfamoyl]piperidine-3-carboxylic acid.
| Compound Name | 1-[(2,6-dichlorophenyl)sulfamoyl]piperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 60857772 |
| Molecular Formula | C12H14Cl2N2O4S |
| Molecular Weight | 353.23 g/mol |
| Exact Mass | 352.01 |
| IUPAC Name | 1-[(2,6-dichlorophenyl)sulfamoyl]piperidine-3-carboxylic acid |
| SMILES | O=C(O)C1CCCN(S(=O)(=O)Nc2c(Cl)cccc2Cl)C1 |
| InChI | InChI=1S/C12H14Cl2N2O4S/c13-9-4-1-5-10(14)11(9)15-21(19,20)16-6-2-3-8(7-16)12(17)18/h1,4-5,8,15H,2-3,6-7H2,(H,17,18) |
| InChIKey | HBFYIHKLRCCQCA-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.23 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |