About N-(6-amino-4-methoxy-1,3-benzothiazol-2-yl)propane-2-sulfonamide
N-(6-amino-4-methoxy-1,3-benzothiazol-2-yl)propane-2-sulfonamide (PubChem CID 60860065) has the molecular formula C11H15N3O3S2
and a molecular weight of 301.39 g/mol. Its IUPAC name is N-(6-amino-4-methoxy-1,3-benzothiazol-2-yl)propane-2-sulfonamide.
Molecular Properties
| Compound Name | N-(6-amino-4-methoxy-1,3-benzothiazol-2-yl)propane-2-sulfonamide |
| PubChem CID | 60860065 |
| Molecular Formula | C11H15N3O3S2 |
| Molecular Weight | 301.39 g/mol |
| Exact Mass | 301.06 |
| IUPAC Name | N-(6-amino-4-methoxy-1,3-benzothiazol-2-yl)propane-2-sulfonamide |
| SMILES | COc1cc(N)cc2sc(NS(=O)(=O)C(C)C)nc12 |
| InChI | InChI=1S/C11H15N3O3S2/c1-6(2)19(15,16)14-11-13-10-8(17-3)4-7(12)5-9(10)18-11/h4-6H,12H2,1-3H3,(H,13,14) |
| InChIKey | YGLMUPZNQJMMDH-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 94.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 301.39 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze N-(6-amino-4-methoxy-1,3-benzothiazol-2-yl)propane-2-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(6-amino-4-methoxy-1,3-benzothiazol-2-yl)propane-2-sulfonamide?
The IUPAC name of N-(6-amino-4-methoxy-1,3-benzothiazol-2-yl)propane-2-sulfonamide (CID 60860065) is N-(6-amino-4-methoxy-1,3-benzothiazol-2-yl)propane-2-sulfonamide.
What is the SMILES notation for N-(6-amino-4-methoxy-1,3-benzothiazol-2-yl)propane-2-sulfonamide?
The canonical SMILES for N-(6-amino-4-methoxy-1,3-benzothiazol-2-yl)propane-2-sulfonamide is COc1cc(N)cc2sc(NS(=O)(=O)C(C)C)nc12.
What is the InChIKey of N-(6-amino-4-methoxy-1,3-benzothiazol-2-yl)propane-2-sulfonamide?
The InChIKey is YGLMUPZNQJMMDH-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15N3O3S2/c1-6(2)19(15,16)14-11-13-10-8(17-3)4-7(12)5-9(10)18-11/h4-6H,12H2,1-3H3,(H,13,14).
What are the key properties of N-(6-amino-4-methoxy-1,3-benzothiazol-2-yl)propane-2-sulfonamide?
N-(6-amino-4-methoxy-1,3-benzothiazol-2-yl)propane-2-sulfonamide has a molecular weight of 301.39 g/mol, XLogP of 2.04, 4 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-(6-amino-4-methoxy-1,3-benzothiazol-2-yl)propane-2-sulfonamide is sourced from PubChem (CID 60860065), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).