C17H22N6O — CID 6086009
5,7-dimethyl-N-[(Z)-1-(4-methylcyclohex-3-en-1-yl)ethylideneamino]-[1,2,4]triazolo[1,5-a]pyrimidine-2-carboxamide (PubChem CID 6086009) has the molecular formula C17H22N6O and a molecular weight of 326.40 g/mol. Its IUPAC name is 5,7-dimethyl-N-[(Z)-1-(4-methylcyclohex-3-en-1-yl)ethylideneamino]-[1,2,4]triazolo[1,5-a]pyrimidine-2-carboxamide.
| Compound Name | 5,7-dimethyl-N-[(Z)-1-(4-methylcyclohex-3-en-1-yl)ethylideneamino]-[1,2,4]triazolo[1,5-a]pyrimidine-2-carboxamide |
|---|---|
| PubChem CID | 6086009 |
| Molecular Formula | C17H22N6O |
| Molecular Weight | 326.40 g/mol |
| Exact Mass | 326.19 |
| IUPAC Name | 5,7-dimethyl-N-[(Z)-1-(4-methylcyclohex-3-en-1-yl)ethylideneamino]-[1,2,4]triazolo[1,5-a]pyrimidine-2-carboxamide |
| SMILES | CC1=CCC(/C(C)=N\NC(=O)c2nc3nc(C)cc(C)n3n2)CC1 |
| InChI | InChI=1S/C17H22N6O/c1-10-5-7-14(8-6-10)13(4)20-21-16(24)15-19-17-18-11(2)9-12(3)23(17)22-15/h5,9,14H,6-8H2,1-4H3,(H,21,24)/b20-13- |
| InChIKey | HJRGDIONXGVLAT-MOSHPQCFSA-N |
| XLogP | 2.59 |
| TPSA | 84.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.40 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|