C13H15Cl2N3O — CID 60862901
4-[5-chloro-2-(1-chloroethyl)benzimidazol-1-yl]butanamide (PubChem CID 60862901) has the molecular formula C13H15Cl2N3O and a molecular weight of 300.19 g/mol. Its IUPAC name is 4-[5-chloro-2-(1-chloroethyl)benzimidazol-1-yl]butanamide.
| Compound Name | 4-[5-chloro-2-(1-chloroethyl)benzimidazol-1-yl]butanamide |
|---|---|
| PubChem CID | 60862901 |
| Molecular Formula | C13H15Cl2N3O |
| Molecular Weight | 300.19 g/mol |
| Exact Mass | 299.06 |
| IUPAC Name | 4-[5-chloro-2-(1-chloroethyl)benzimidazol-1-yl]butanamide |
| SMILES | CC(Cl)c1nc2cc(Cl)ccc2n1CCCC(N)=O |
| InChI | InChI=1S/C13H15Cl2N3O/c1-8(14)13-17-10-7-9(15)4-5-11(10)18(13)6-2-3-12(16)19/h4-5,7-8H,2-3,6H2,1H3,(H2,16,19) |
| InChIKey | PEGCRQDSDBULKM-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 60.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.19 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|