C13H18N4O — CID 60863042
4-[(2-methylimidazo[1,2-a]pyridin-3-yl)methylamino]butanamide (PubChem CID 60863042) has the molecular formula C13H18N4O and a molecular weight of 246.31 g/mol. Its IUPAC name is 4-[(2-methylimidazo[1,2-a]pyridin-3-yl)methylamino]butanamide.
| Compound Name | 4-[(2-methylimidazo[1,2-a]pyridin-3-yl)methylamino]butanamide |
|---|---|
| PubChem CID | 60863042 |
| Molecular Formula | C13H18N4O |
| Molecular Weight | 246.31 g/mol |
| Exact Mass | 246.15 |
| IUPAC Name | 4-[(2-methylimidazo[1,2-a]pyridin-3-yl)methylamino]butanamide |
| SMILES | Cc1nc2ccccn2c1CNCCCC(N)=O |
| InChI | InChI=1S/C13H18N4O/c1-10-11(9-15-7-4-5-12(14)18)17-8-3-2-6-13(17)16-10/h2-3,6,8,15H,4-5,7,9H2,1H3,(H2,14,18) |
| InChIKey | XEBQZALIFUJKNE-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 72.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.31 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|