About 2-piperidin-2-yl-N-(2,2,2-trifluoroethyl)ethanesulfonamide
2-piperidin-2-yl-N-(2,2,2-trifluoroethyl)ethanesulfonamide (PubChem CID 60864187) has the molecular formula C9H17F3N2O2S
and a molecular weight of 274.31 g/mol. Its IUPAC name is 2-piperidin-2-yl-N-(2,2,2-trifluoroethyl)ethanesulfonamide.
Molecular Properties
| Compound Name | 2-piperidin-2-yl-N-(2,2,2-trifluoroethyl)ethanesulfonamide |
| PubChem CID | 60864187 |
| Molecular Formula | C9H17F3N2O2S |
| Molecular Weight | 274.31 g/mol |
| Exact Mass | 274.10 |
| IUPAC Name | 2-piperidin-2-yl-N-(2,2,2-trifluoroethyl)ethanesulfonamide |
| SMILES | O=S(=O)(CCC1CCCCN1)NCC(F)(F)F |
| InChI | InChI=1S/C9H17F3N2O2S/c10-9(11,12)7-14-17(15,16)6-4-8-3-1-2-5-13-8/h8,13-14H,1-7H2 |
| InChIKey | KMBRSWKIWQOVRZ-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.31 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-piperidin-2-yl-N-(2,2,2-trifluoroethyl)ethanesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-piperidin-2-yl-N-(2,2,2-trifluoroethyl)ethanesulfonamide?
The IUPAC name of 2-piperidin-2-yl-N-(2,2,2-trifluoroethyl)ethanesulfonamide (CID 60864187) is 2-piperidin-2-yl-N-(2,2,2-trifluoroethyl)ethanesulfonamide.
What is the SMILES notation for 2-piperidin-2-yl-N-(2,2,2-trifluoroethyl)ethanesulfonamide?
The canonical SMILES for 2-piperidin-2-yl-N-(2,2,2-trifluoroethyl)ethanesulfonamide is O=S(=O)(CCC1CCCCN1)NCC(F)(F)F.
What is the InChIKey of 2-piperidin-2-yl-N-(2,2,2-trifluoroethyl)ethanesulfonamide?
The InChIKey is KMBRSWKIWQOVRZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17F3N2O2S/c10-9(11,12)7-14-17(15,16)6-4-8-3-1-2-5-13-8/h8,13-14H,1-7H2.
What are the key properties of 2-piperidin-2-yl-N-(2,2,2-trifluoroethyl)ethanesulfonamide?
2-piperidin-2-yl-N-(2,2,2-trifluoroethyl)ethanesulfonamide has a molecular weight of 274.31 g/mol, XLogP of 1.00, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-piperidin-2-yl-N-(2,2,2-trifluoroethyl)ethanesulfonamide is sourced from PubChem (CID 60864187), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).