C9H12N2O3 — CID 60864499
4-(3-methyl-2,5-dioxopyrrol-1-yl)butanamide (PubChem CID 60864499) has the molecular formula C9H12N2O3 and a molecular weight of 196.21 g/mol. Its IUPAC name is 4-(3-methyl-2,5-dioxopyrrol-1-yl)butanamide.
| Compound Name | 4-(3-methyl-2,5-dioxopyrrol-1-yl)butanamide |
|---|---|
| PubChem CID | 60864499 |
| Molecular Formula | C9H12N2O3 |
| Molecular Weight | 196.21 g/mol |
| Exact Mass | 196.08 |
| IUPAC Name | 4-(3-methyl-2,5-dioxopyrrol-1-yl)butanamide |
| SMILES | CC1=CC(=O)N(CCCC(N)=O)C1=O |
| InChI | InChI=1S/C9H12N2O3/c1-6-5-8(13)11(9(6)14)4-2-3-7(10)12/h5H,2-4H2,1H3,(H2,10,12) |
| InChIKey | OUOOGTXSIRJXSA-UHFFFAOYSA-N |
| XLogP | -0.43 |
| TPSA | 80.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.21 |
| LogP ≤ 5 | -0.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|