C10H22N2 — CID 60867294
N-(cyclopropylmethyl)-N'-methyl-N'-propan-2-ylethane-1,2-diamine (PubChem CID 60867294) has the molecular formula C10H22N2 and a molecular weight of 170.30 g/mol. Its IUPAC name is N-(cyclopropylmethyl)-N'-methyl-N'-propan-2-ylethane-1,2-diamine.
| Compound Name | N-(cyclopropylmethyl)-N'-methyl-N'-propan-2-ylethane-1,2-diamine |
|---|---|
| PubChem CID | 60867294 |
| Molecular Formula | C10H22N2 |
| Molecular Weight | 170.30 g/mol |
| Exact Mass | 170.18 |
| IUPAC Name | N-(cyclopropylmethyl)-N'-methyl-N'-propan-2-ylethane-1,2-diamine |
| SMILES | CC(C)N(C)CCNCC1CC1 |
| InChI | InChI=1S/C10H22N2/c1-9(2)12(3)7-6-11-8-10-4-5-10/h9-11H,4-8H2,1-3H3 |
| InChIKey | NRPNOHFELOYPNA-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.30 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|