C13H12N2O3S2 — CID 60868645
3-methyl-5-[[(E)-3-(5-methylthiophen-2-yl)prop-2-enoyl]amino]-1,2-thiazole-4-carboxylic acid (PubChem CID 60868645) has the molecular formula C13H12N2O3S2 and a molecular weight of 308.38 g/mol. Its IUPAC name is 3-methyl-5-[[(E)-3-(5-methylthiophen-2-yl)prop-2-enoyl]amino]-1,2-thiazole-4-carboxylic acid.
| Compound Name | 3-methyl-5-[[(E)-3-(5-methylthiophen-2-yl)prop-2-enoyl]amino]-1,2-thiazole-4-carboxylic acid |
|---|---|
| PubChem CID | 60868645 |
| Molecular Formula | C13H12N2O3S2 |
| Molecular Weight | 308.38 g/mol |
| Exact Mass | 308.03 |
| IUPAC Name | 3-methyl-5-[[(E)-3-(5-methylthiophen-2-yl)prop-2-enoyl]amino]-1,2-thiazole-4-carboxylic acid |
| SMILES | Cc1ccc(/C=C/C(=O)Nc2snc(C)c2C(=O)O)s1 |
| InChI | InChI=1S/C13H12N2O3S2/c1-7-3-4-9(19-7)5-6-10(16)14-12-11(13(17)18)8(2)15-20-12/h3-6H,1-2H3,(H,14,16)(H,17,18)/b6-5+ |
| InChIKey | XBTALAVDMCVKDR-AATRIKPKSA-N |
| XLogP | 3.17 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.38 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|