C15H25N3O2S — CID 60869877
3-[4-(2-methylsulfonylphenyl)-1,4-diazepan-1-yl]propan-1-amine (PubChem CID 60869877) has the molecular formula C15H25N3O2S and a molecular weight of 311.45 g/mol. Its IUPAC name is 3-[4-(2-methylsulfonylphenyl)-1,4-diazepan-1-yl]propan-1-amine.
| Compound Name | 3-[4-(2-methylsulfonylphenyl)-1,4-diazepan-1-yl]propan-1-amine |
|---|---|
| PubChem CID | 60869877 |
| Molecular Formula | C15H25N3O2S |
| Molecular Weight | 311.45 g/mol |
| Exact Mass | 311.17 |
| IUPAC Name | 3-[4-(2-methylsulfonylphenyl)-1,4-diazepan-1-yl]propan-1-amine |
| SMILES | CS(=O)(=O)c1ccccc1N1CCCN(CCCN)CC1 |
| InChI | InChI=1S/C15H25N3O2S/c1-21(19,20)15-7-3-2-6-14(15)18-11-5-10-17(12-13-18)9-4-8-16/h2-3,6-7H,4-5,8-13,16H2,1H3 |
| InChIKey | GYLFUKUAEFYQMM-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 66.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.45 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |