C19H17N3OS — CID 608701
1-(3-benzyl-2-methylsulfanylimidazo[4,5-b]indol-4-yl)ethanone (PubChem CID 608701) has the molecular formula C19H17N3OS and a molecular weight of 335.43 g/mol. Its IUPAC name is 1-(3-benzyl-2-methylsulfanylimidazo[4,5-b]indol-4-yl)ethanone.
| Compound Name | 1-(3-benzyl-2-methylsulfanylimidazo[4,5-b]indol-4-yl)ethanone |
|---|---|
| PubChem CID | 608701 |
| Molecular Formula | C19H17N3OS |
| Molecular Weight | 335.43 g/mol |
| Exact Mass | 335.11 |
| IUPAC Name | 1-(3-benzyl-2-methylsulfanylimidazo[4,5-b]indol-4-yl)ethanone |
| SMILES | CSc1nc2c3ccccc3n(C(C)=O)c2n1Cc1ccccc1 |
| InChI | InChI=1S/C19H17N3OS/c1-13(23)22-16-11-7-6-10-15(16)17-18(22)21(19(20-17)24-2)12-14-8-4-3-5-9-14/h3-11H,12H2,1-2H3 |
| InChIKey | NETXQMJNMKRAHM-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 39.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.43 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |