About N'-(5-chloro-2-pyridinyl)-N'-(4-fluorophenyl)propane-1,3-diamine
N'-(5-chloro-2-pyridinyl)-N'-(4-fluorophenyl)propane-1,3-diamine (PubChem CID 60871203) has the molecular formula C14H15ClFN3
and a molecular weight of 279.75 g/mol. Its IUPAC name is N'-(5-chloro-2-pyridinyl)-N'-(4-fluorophenyl)propane-1,3-diamine.
Molecular Properties
| Compound Name | N'-(5-chloro-2-pyridinyl)-N'-(4-fluorophenyl)propane-1,3-diamine |
| PubChem CID | 60871203 |
| Molecular Formula | C14H15ClFN3 |
| Molecular Weight | 279.75 g/mol |
| Exact Mass | 279.09 |
| IUPAC Name | N'-(5-chloro-2-pyridinyl)-N'-(4-fluorophenyl)propane-1,3-diamine |
| SMILES | NCCCN(c1ccc(F)cc1)c1ccc(Cl)cn1 |
| InChI | InChI=1S/C14H15ClFN3/c15-11-2-7-14(18-10-11)19(9-1-8-17)13-5-3-12(16)4-6-13/h2-7,10H,1,8-9,17H2 |
| InChIKey | NXPSGRWDZXGIIF-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 279.75 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N'-(5-chloro-2-pyridinyl)-N'-(4-fluorophenyl)propane-1,3-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-(5-chloro-2-pyridinyl)-N'-(4-fluorophenyl)propane-1,3-diamine?
The IUPAC name of N'-(5-chloro-2-pyridinyl)-N'-(4-fluorophenyl)propane-1,3-diamine (CID 60871203) is N'-(5-chloro-2-pyridinyl)-N'-(4-fluorophenyl)propane-1,3-diamine.
What is the SMILES notation for N'-(5-chloro-2-pyridinyl)-N'-(4-fluorophenyl)propane-1,3-diamine?
The canonical SMILES for N'-(5-chloro-2-pyridinyl)-N'-(4-fluorophenyl)propane-1,3-diamine is NCCCN(c1ccc(F)cc1)c1ccc(Cl)cn1.
What is the InChIKey of N'-(5-chloro-2-pyridinyl)-N'-(4-fluorophenyl)propane-1,3-diamine?
The InChIKey is NXPSGRWDZXGIIF-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H15ClFN3/c15-11-2-7-14(18-10-11)19(9-1-8-17)13-5-3-12(16)4-6-13/h2-7,10H,1,8-9,17H2.
What are the key properties of N'-(5-chloro-2-pyridinyl)-N'-(4-fluorophenyl)propane-1,3-diamine?
N'-(5-chloro-2-pyridinyl)-N'-(4-fluorophenyl)propane-1,3-diamine has a molecular weight of 279.75 g/mol, XLogP of 3.36, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N'-(5-chloro-2-pyridinyl)-N'-(4-fluorophenyl)propane-1,3-diamine is sourced from PubChem (CID 60871203), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).