C8H15N5O2 — CID 60871209
6-[3-aminopropyl(ethyl)amino]-2H-1,2,4-triazine-3,5-dione (PubChem CID 60871209) has the molecular formula C8H15N5O2 and a molecular weight of 213.24 g/mol. Its IUPAC name is 6-[3-aminopropyl(ethyl)amino]-2H-1,2,4-triazine-3,5-dione.
| Compound Name | 6-[3-aminopropyl(ethyl)amino]-2H-1,2,4-triazine-3,5-dione |
|---|---|
| PubChem CID | 60871209 |
| Molecular Formula | C8H15N5O2 |
| Molecular Weight | 213.24 g/mol |
| Exact Mass | 213.12 |
| IUPAC Name | 6-[3-aminopropyl(ethyl)amino]-2H-1,2,4-triazine-3,5-dione |
| SMILES | CCN(CCCN)c1n[nH]c(=O)[nH]c1=O |
| InChI | InChI=1S/C8H15N5O2/c1-2-13(5-3-4-9)6-7(14)10-8(15)12-11-6/h2-5,9H2,1H3,(H2,10,12,14,15) |
| InChIKey | YIQKFMYRNMBBLW-UHFFFAOYSA-N |
| XLogP | -1.37 |
| TPSA | 107.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.24 |
| LogP ≤ 5 | -1.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |