C13H17N5O3 — CID 60871405
6-[N-(3-aminopropyl)-3-methoxyanilino]-2H-1,2,4-triazine-3,5-dione (PubChem CID 60871405) has the molecular formula C13H17N5O3 and a molecular weight of 291.31 g/mol. Its IUPAC name is 6-[N-(3-aminopropyl)-3-methoxyanilino]-2H-1,2,4-triazine-3,5-dione.
| Compound Name | 6-[N-(3-aminopropyl)-3-methoxyanilino]-2H-1,2,4-triazine-3,5-dione |
|---|---|
| PubChem CID | 60871405 |
| Molecular Formula | C13H17N5O3 |
| Molecular Weight | 291.31 g/mol |
| Exact Mass | 291.13 |
| IUPAC Name | 6-[N-(3-aminopropyl)-3-methoxyanilino]-2H-1,2,4-triazine-3,5-dione |
| SMILES | COc1cccc(N(CCCN)c2n[nH]c(=O)[nH]c2=O)c1 |
| InChI | InChI=1S/C13H17N5O3/c1-21-10-5-2-4-9(8-10)18(7-3-6-14)11-12(19)15-13(20)17-16-11/h2,4-5,8H,3,6-7,14H2,1H3,(H2,15,17,19,20) |
| InChIKey | CUXFAFIMLLACFX-UHFFFAOYSA-N |
| XLogP | -0.05 |
| TPSA | 117.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.31 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |