C11H11BrO4S — CID 60873963
3-(2-bromoprop-2-enylsulfonyl)-4-methylbenzoic acid (PubChem CID 60873963) has the molecular formula C11H11BrO4S and a molecular weight of 319.18 g/mol. Its IUPAC name is 3-(2-bromoprop-2-enylsulfonyl)-4-methylbenzoic acid.
| Compound Name | 3-(2-bromoprop-2-enylsulfonyl)-4-methylbenzoic acid |
|---|---|
| PubChem CID | 60873963 |
| Molecular Formula | C11H11BrO4S |
| Molecular Weight | 319.18 g/mol |
| Exact Mass | 317.96 |
| IUPAC Name | 3-(2-bromoprop-2-enylsulfonyl)-4-methylbenzoic acid |
| SMILES | C=C(Br)CS(=O)(=O)c1cc(C(=O)O)ccc1C |
| InChI | InChI=1S/C11H11BrO4S/c1-7-3-4-9(11(13)14)5-10(7)17(15,16)6-8(2)12/h3-5H,2,6H2,1H3,(H,13,14) |
| InChIKey | ATYGVLMEYPJZPI-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.18 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |