C23H19BrN4O5 — CID 6087492
(4E)-4-[(4-bromophenyl)-hydroxymethylidene]-1-(3-imidazol-1-ylpropyl)-5-(2-nitrophenyl)pyrrolidine-2,3-dione (PubChem CID 6087492) has the molecular formula C23H19BrN4O5 and a molecular weight of 511.33 g/mol. Its IUPAC name is (4E)-4-[(4-bromophenyl)-hydroxymethylidene]-1-(3-imidazol-1-ylpropyl)-5-(2-nitrophenyl)pyrrolidine-2,3-dione.
| Compound Name | (4E)-4-[(4-bromophenyl)-hydroxymethylidene]-1-(3-imidazol-1-ylpropyl)-5-(2-nitrophenyl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 6087492 |
| Molecular Formula | C23H19BrN4O5 |
| Molecular Weight | 511.33 g/mol |
| Exact Mass | 510.05 |
| IUPAC Name | (4E)-4-[(4-bromophenyl)-hydroxymethylidene]-1-(3-imidazol-1-ylpropyl)-5-(2-nitrophenyl)pyrrolidine-2,3-dione |
| SMILES | O=C1C(=O)N(CCCn2ccnc2)C(c2ccccc2[N+](=O)[O-])/C1=C(\O)c1ccc(Br)cc1 |
| InChI | InChI=1S/C23H19BrN4O5/c24-16-8-6-15(7-9-16)21(29)19-20(17-4-1-2-5-18(17)28(32)33)27(23(31)22(19)30)12-3-11-26-13-10-25-14-26/h1-2,4-10,13-14,20,29H,3,11-12H2/b21-19+ |
| InChIKey | NNEJEBQLHQSNAT-XUTLUUPISA-N |
| XLogP | 4.07 |
| TPSA | 118.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.33 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|