About 1-[3-[4-(chloromethyl)-1,3-thiazol-2-yl]propyl]-6-methylpyridin-2-one
1-[3-[4-(chloromethyl)-1,3-thiazol-2-yl]propyl]-6-methylpyridin-2-one (PubChem CID 60876046) has the molecular formula C13H15ClN2OS
and a molecular weight of 282.80 g/mol. Its IUPAC name is 1-[3-[4-(chloromethyl)-1,3-thiazol-2-yl]propyl]-6-methylpyridin-2-one.
Molecular Properties
| Compound Name | 1-[3-[4-(chloromethyl)-1,3-thiazol-2-yl]propyl]-6-methylpyridin-2-one |
| PubChem CID | 60876046 |
| Molecular Formula | C13H15ClN2OS |
| Molecular Weight | 282.80 g/mol |
| Exact Mass | 282.06 |
| IUPAC Name | 1-[3-[4-(chloromethyl)-1,3-thiazol-2-yl]propyl]-6-methylpyridin-2-one |
| SMILES | Cc1cccc(=O)n1CCCc1nc(CCl)cs1 |
| InChI | InChI=1S/C13H15ClN2OS/c1-10-4-2-6-13(17)16(10)7-3-5-12-15-11(8-14)9-18-12/h2,4,6,9H,3,5,7-8H2,1H3 |
| InChIKey | AAFICIXIJKZIJO-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.80 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 1-[3-[4-(chloromethyl)-1,3-thiazol-2-yl]propyl]-6-methylpyridin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[3-[4-(chloromethyl)-1,3-thiazol-2-yl]propyl]-6-methylpyridin-2-one?
The IUPAC name of 1-[3-[4-(chloromethyl)-1,3-thiazol-2-yl]propyl]-6-methylpyridin-2-one (CID 60876046) is 1-[3-[4-(chloromethyl)-1,3-thiazol-2-yl]propyl]-6-methylpyridin-2-one.
What is the SMILES notation for 1-[3-[4-(chloromethyl)-1,3-thiazol-2-yl]propyl]-6-methylpyridin-2-one?
The canonical SMILES for 1-[3-[4-(chloromethyl)-1,3-thiazol-2-yl]propyl]-6-methylpyridin-2-one is Cc1cccc(=O)n1CCCc1nc(CCl)cs1.
What is the InChIKey of 1-[3-[4-(chloromethyl)-1,3-thiazol-2-yl]propyl]-6-methylpyridin-2-one?
The InChIKey is AAFICIXIJKZIJO-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15ClN2OS/c1-10-4-2-6-13(17)16(10)7-3-5-12-15-11(8-14)9-18-12/h2,4,6,9H,3,5,7-8H2,1H3.
What are the key properties of 1-[3-[4-(chloromethyl)-1,3-thiazol-2-yl]propyl]-6-methylpyridin-2-one?
1-[3-[4-(chloromethyl)-1,3-thiazol-2-yl]propyl]-6-methylpyridin-2-one has a molecular weight of 282.80 g/mol, XLogP of 2.98, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[3-[4-(chloromethyl)-1,3-thiazol-2-yl]propyl]-6-methylpyridin-2-one is sourced from PubChem (CID 60876046), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).