C10H8F3N3S2 — CID 60876558
4-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]-2-(trifluoromethyl)aniline (PubChem CID 60876558) has the molecular formula C10H8F3N3S2 and a molecular weight of 291.32 g/mol. Its IUPAC name is 4-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]-2-(trifluoromethyl)aniline.
| Compound Name | 4-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]-2-(trifluoromethyl)aniline |
|---|---|
| PubChem CID | 60876558 |
| Molecular Formula | C10H8F3N3S2 |
| Molecular Weight | 291.32 g/mol |
| Exact Mass | 291.01 |
| IUPAC Name | 4-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]-2-(trifluoromethyl)aniline |
| SMILES | Cc1nnc(Sc2ccc(N)c(C(F)(F)F)c2)s1 |
| InChI | InChI=1S/C10H8F3N3S2/c1-5-15-16-9(17-5)18-6-2-3-8(14)7(4-6)10(11,12)13/h2-4H,14H2,1H3 |
| InChIKey | MMFZIAGMHMYMJI-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.32 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|