C16H18N4S — CID 60876647
N-[(2-aminophenyl)methyl]-N-propan-2-ylthieno[2,3-d]pyrimidin-4-amine (PubChem CID 60876647) has the molecular formula C16H18N4S and a molecular weight of 298.42 g/mol. Its IUPAC name is N-[(2-aminophenyl)methyl]-N-propan-2-ylthieno[2,3-d]pyrimidin-4-amine.
| Compound Name | N-[(2-aminophenyl)methyl]-N-propan-2-ylthieno[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 60876647 |
| Molecular Formula | C16H18N4S |
| Molecular Weight | 298.42 g/mol |
| Exact Mass | 298.13 |
| IUPAC Name | N-[(2-aminophenyl)methyl]-N-propan-2-ylthieno[2,3-d]pyrimidin-4-amine |
| SMILES | CC(C)N(Cc1ccccc1N)c1ncnc2sccc12 |
| InChI | InChI=1S/C16H18N4S/c1-11(2)20(9-12-5-3-4-6-14(12)17)15-13-7-8-21-16(13)19-10-18-15/h3-8,10-11H,9,17H2,1-2H3 |
| InChIKey | LAYUENIJNJLJTH-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 55.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.42 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|