About 2-methyl-3-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]propanimidamide
2-methyl-3-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]propanimidamide (PubChem CID 60876759) has the molecular formula C7H12N4S2
and a molecular weight of 216.34 g/mol. Its IUPAC name is 2-methyl-3-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]propanimidamide.
Molecular Properties
| Compound Name | 2-methyl-3-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]propanimidamide |
| PubChem CID | 60876759 |
| Molecular Formula | C7H12N4S2 |
| Molecular Weight | 216.34 g/mol |
| Exact Mass | 216.05 |
| IUPAC Name | 2-methyl-3-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]propanimidamide |
| SMILES | [H]/N=C(\N)C(C)CSc1nnc(C)s1 |
| InChI | InChI=1S/C7H12N4S2/c1-4(6(8)9)3-12-7-11-10-5(2)13-7/h4H,3H2,1-2H3,(H3,8,9) |
| InChIKey | UOSRODXSACXBHW-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 75.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.34 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 2-methyl-3-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]propanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-3-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]propanimidamide?
The IUPAC name of 2-methyl-3-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]propanimidamide (CID 60876759) is 2-methyl-3-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]propanimidamide.
What is the SMILES notation for 2-methyl-3-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]propanimidamide?
The canonical SMILES for 2-methyl-3-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]propanimidamide is [H]/N=C(\N)C(C)CSc1nnc(C)s1.
What is the InChIKey of 2-methyl-3-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]propanimidamide?
The InChIKey is UOSRODXSACXBHW-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12N4S2/c1-4(6(8)9)3-12-7-11-10-5(2)13-7/h4H,3H2,1-2H3,(H3,8,9).
What are the key properties of 2-methyl-3-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]propanimidamide?
2-methyl-3-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]propanimidamide has a molecular weight of 216.34 g/mol, XLogP of 1.51, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-3-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]propanimidamide is sourced from PubChem (CID 60876759), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).