C13H15N5O2 — CID 60876858
6-[(2-aminophenyl)methyl-cyclopropylamino]-2H-1,2,4-triazine-3,5-dione (PubChem CID 60876858) has the molecular formula C13H15N5O2 and a molecular weight of 273.30 g/mol. Its IUPAC name is 6-[(2-aminophenyl)methyl-cyclopropylamino]-2H-1,2,4-triazine-3,5-dione.
| Compound Name | 6-[(2-aminophenyl)methyl-cyclopropylamino]-2H-1,2,4-triazine-3,5-dione |
|---|---|
| PubChem CID | 60876858 |
| Molecular Formula | C13H15N5O2 |
| Molecular Weight | 273.30 g/mol |
| Exact Mass | 273.12 |
| IUPAC Name | 6-[(2-aminophenyl)methyl-cyclopropylamino]-2H-1,2,4-triazine-3,5-dione |
| SMILES | Nc1ccccc1CN(c1n[nH]c(=O)[nH]c1=O)C1CC1 |
| InChI | InChI=1S/C13H15N5O2/c14-10-4-2-1-3-8(10)7-18(9-5-6-9)11-12(19)15-13(20)17-16-11/h1-4,9H,5-7,14H2,(H2,15,17,19,20) |
| InChIKey | IKUOTKMWCYWHMK-UHFFFAOYSA-N |
| XLogP | 0.21 |
| TPSA | 107.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.30 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|