C18H24IN7O — CID 6087718
N-[(Z)-(5-iodofuran-2-yl)methylideneamino]-4,6-di(piperidin-1-yl)-1,3,5-triazin-2-amine (PubChem CID 6087718) has the molecular formula C18H24IN7O and a molecular weight of 481.34 g/mol. Its IUPAC name is N-[(Z)-(5-iodofuran-2-yl)methylideneamino]-4,6-di(piperidin-1-yl)-1,3,5-triazin-2-amine.
| Compound Name | N-[(Z)-(5-iodofuran-2-yl)methylideneamino]-4,6-di(piperidin-1-yl)-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 6087718 |
| Molecular Formula | C18H24IN7O |
| Molecular Weight | 481.34 g/mol |
| Exact Mass | 481.11 |
| IUPAC Name | N-[(Z)-(5-iodofuran-2-yl)methylideneamino]-4,6-di(piperidin-1-yl)-1,3,5-triazin-2-amine |
| SMILES | Ic1ccc(/C=N\Nc2nc(N3CCCCC3)nc(N3CCCCC3)n2)o1 |
| InChI | InChI=1S/C18H24IN7O/c19-15-8-7-14(27-15)13-20-24-16-21-17(25-9-3-1-4-10-25)23-18(22-16)26-11-5-2-6-12-26/h7-8,13H,1-6,9-12H2,(H,21,22,23,24)/b20-13- |
| InChIKey | DQPYJDSVSPGBEA-MOSHPQCFSA-N |
| XLogP | 3.50 |
| TPSA | 82.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.34 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|