About 4-(3-fluorophenoxy)-1,1-dioxothiolan-3-ol
4-(3-fluorophenoxy)-1,1-dioxothiolan-3-ol (PubChem CID 60878596) has the molecular formula C10H11FO4S
and a molecular weight of 246.26 g/mol. Its IUPAC name is 4-(3-fluorophenoxy)-1,1-dioxothiolan-3-ol.
Molecular Properties
| Compound Name | 4-(3-fluorophenoxy)-1,1-dioxothiolan-3-ol |
| PubChem CID | 60878596 |
| Molecular Formula | C10H11FO4S |
| Molecular Weight | 246.26 g/mol |
| Exact Mass | 246.04 |
| IUPAC Name | 4-(3-fluorophenoxy)-1,1-dioxothiolan-3-ol |
| SMILES | O=S1(=O)CC(O)C(Oc2cccc(F)c2)C1 |
| InChI | InChI=1S/C10H11FO4S/c11-7-2-1-3-8(4-7)15-10-6-16(13,14)5-9(10)12/h1-4,9-10,12H,5-6H2 |
| InChIKey | RPFAPSSOVFVNGT-UHFFFAOYSA-N |
| XLogP | 0.36 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.26 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-(3-fluorophenoxy)-1,1-dioxothiolan-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(3-fluorophenoxy)-1,1-dioxothiolan-3-ol?
The IUPAC name of 4-(3-fluorophenoxy)-1,1-dioxothiolan-3-ol (CID 60878596) is 4-(3-fluorophenoxy)-1,1-dioxothiolan-3-ol.
What is the SMILES notation for 4-(3-fluorophenoxy)-1,1-dioxothiolan-3-ol?
The canonical SMILES for 4-(3-fluorophenoxy)-1,1-dioxothiolan-3-ol is O=S1(=O)CC(O)C(Oc2cccc(F)c2)C1.
What is the InChIKey of 4-(3-fluorophenoxy)-1,1-dioxothiolan-3-ol?
The InChIKey is RPFAPSSOVFVNGT-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11FO4S/c11-7-2-1-3-8(4-7)15-10-6-16(13,14)5-9(10)12/h1-4,9-10,12H,5-6H2.
What are the key properties of 4-(3-fluorophenoxy)-1,1-dioxothiolan-3-ol?
4-(3-fluorophenoxy)-1,1-dioxothiolan-3-ol has a molecular weight of 246.26 g/mol, XLogP of 0.36, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(3-fluorophenoxy)-1,1-dioxothiolan-3-ol is sourced from PubChem (CID 60878596), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).