About 3,4-dichlorothiophene-2,5-dicarbonitrile
3,4-dichlorothiophene-2,5-dicarbonitrile (PubChem CID 608818) has the molecular formula C6Cl2N2S
and a molecular weight of 203.05 g/mol. Its IUPAC name is 3,4-dichlorothiophene-2,5-dicarbonitrile.
Molecular Properties
| Compound Name | 3,4-dichlorothiophene-2,5-dicarbonitrile |
| PubChem CID | 608818 |
| Molecular Formula | C6Cl2N2S |
| Molecular Weight | 203.05 g/mol |
| Exact Mass | 201.92 |
| IUPAC Name | 3,4-dichlorothiophene-2,5-dicarbonitrile |
| SMILES | N#Cc1sc(C#N)c(Cl)c1Cl |
| InChI | InChI=1S/C6Cl2N2S/c7-5-3(1-9)11-4(2-10)6(5)8 |
| InChIKey | ZPRXPUQEULTGOF-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 47.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.05 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3,4-dichlorothiophene-2,5-dicarbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,4-dichlorothiophene-2,5-dicarbonitrile?
The IUPAC name of 3,4-dichlorothiophene-2,5-dicarbonitrile (CID 608818) is 3,4-dichlorothiophene-2,5-dicarbonitrile.
What is the SMILES notation for 3,4-dichlorothiophene-2,5-dicarbonitrile?
The canonical SMILES for 3,4-dichlorothiophene-2,5-dicarbonitrile is N#Cc1sc(C#N)c(Cl)c1Cl.
What is the InChIKey of 3,4-dichlorothiophene-2,5-dicarbonitrile?
The InChIKey is ZPRXPUQEULTGOF-UHFFFAOYSA-N. The full InChI is InChI=1S/C6Cl2N2S/c7-5-3(1-9)11-4(2-10)6(5)8.
What are the key properties of 3,4-dichlorothiophene-2,5-dicarbonitrile?
3,4-dichlorothiophene-2,5-dicarbonitrile has a molecular weight of 203.05 g/mol, XLogP of 2.80, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3,4-dichlorothiophene-2,5-dicarbonitrile is sourced from PubChem (CID 608818), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).