About 2-ethyl-4-(4-hydroxy-1,1-dioxothiolan-3-yl)sulfanyl-6-methylpyrimidine-5-carboxylic acid
2-ethyl-4-(4-hydroxy-1,1-dioxothiolan-3-yl)sulfanyl-6-methylpyrimidine-5-carboxylic acid (PubChem CID 60883818) has the molecular formula C12H16N2O5S2
and a molecular weight of 332.40 g/mol. Its IUPAC name is 2-ethyl-4-(4-hydroxy-1,1-dioxothiolan-3-yl)sulfanyl-6-methylpyrimidine-5-carboxylic acid.
Molecular Properties
| Compound Name | 2-ethyl-4-(4-hydroxy-1,1-dioxothiolan-3-yl)sulfanyl-6-methylpyrimidine-5-carboxylic acid |
| PubChem CID | 60883818 |
| Molecular Formula | C12H16N2O5S2 |
| Molecular Weight | 332.40 g/mol |
| Exact Mass | 332.05 |
| IUPAC Name | 2-ethyl-4-(4-hydroxy-1,1-dioxothiolan-3-yl)sulfanyl-6-methylpyrimidine-5-carboxylic acid |
| SMILES | CCc1nc(C)c(C(=O)O)c(SC2CS(=O)(=O)CC2O)n1 |
| InChI | InChI=1S/C12H16N2O5S2/c1-3-9-13-6(2)10(12(16)17)11(14-9)20-8-5-21(18,19)4-7(8)15/h7-8,15H,3-5H2,1-2H3,(H,16,17) |
| InChIKey | SMEHQHBDDHJRRJ-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 117.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 332.40 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 2-ethyl-4-(4-hydroxy-1,1-dioxothiolan-3-yl)sulfanyl-6-methylpyrimidine-5-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethyl-4-(4-hydroxy-1,1-dioxothiolan-3-yl)sulfanyl-6-methylpyrimidine-5-carboxylic acid?
The IUPAC name of 2-ethyl-4-(4-hydroxy-1,1-dioxothiolan-3-yl)sulfanyl-6-methylpyrimidine-5-carboxylic acid (CID 60883818) is 2-ethyl-4-(4-hydroxy-1,1-dioxothiolan-3-yl)sulfanyl-6-methylpyrimidine-5-carboxylic acid.
What is the SMILES notation for 2-ethyl-4-(4-hydroxy-1,1-dioxothiolan-3-yl)sulfanyl-6-methylpyrimidine-5-carboxylic acid?
The canonical SMILES for 2-ethyl-4-(4-hydroxy-1,1-dioxothiolan-3-yl)sulfanyl-6-methylpyrimidine-5-carboxylic acid is CCc1nc(C)c(C(=O)O)c(SC2CS(=O)(=O)CC2O)n1.
What is the InChIKey of 2-ethyl-4-(4-hydroxy-1,1-dioxothiolan-3-yl)sulfanyl-6-methylpyrimidine-5-carboxylic acid?
The InChIKey is SMEHQHBDDHJRRJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16N2O5S2/c1-3-9-13-6(2)10(12(16)17)11(14-9)20-8-5-21(18,19)4-7(8)15/h7-8,15H,3-5H2,1-2H3,(H,16,17).
What are the key properties of 2-ethyl-4-(4-hydroxy-1,1-dioxothiolan-3-yl)sulfanyl-6-methylpyrimidine-5-carboxylic acid?
2-ethyl-4-(4-hydroxy-1,1-dioxothiolan-3-yl)sulfanyl-6-methylpyrimidine-5-carboxylic acid has a molecular weight of 332.40 g/mol, XLogP of 0.30, 4 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethyl-4-(4-hydroxy-1,1-dioxothiolan-3-yl)sulfanyl-6-methylpyrimidine-5-carboxylic acid is sourced from PubChem (CID 60883818), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).