C7H16N2O5S2 — CID 60884251
N-[2-[(4-hydroxy-1,1-dioxothiolan-3-yl)amino]ethyl]methanesulfonamide (PubChem CID 60884251) has the molecular formula C7H16N2O5S2 and a molecular weight of 272.35 g/mol. Its IUPAC name is N-[2-[(4-hydroxy-1,1-dioxothiolan-3-yl)amino]ethyl]methanesulfonamide.
| Compound Name | N-[2-[(4-hydroxy-1,1-dioxothiolan-3-yl)amino]ethyl]methanesulfonamide |
|---|---|
| PubChem CID | 60884251 |
| Molecular Formula | C7H16N2O5S2 |
| Molecular Weight | 272.35 g/mol |
| Exact Mass | 272.05 |
| IUPAC Name | N-[2-[(4-hydroxy-1,1-dioxothiolan-3-yl)amino]ethyl]methanesulfonamide |
| SMILES | CS(=O)(=O)NCCNC1CS(=O)(=O)CC1O |
| InChI | InChI=1S/C7H16N2O5S2/c1-15(11,12)9-3-2-8-6-4-16(13,14)5-7(6)10/h6-10H,2-5H2,1H3 |
| InChIKey | KDCZCIOMAPQEML-UHFFFAOYSA-N |
| XLogP | -2.72 |
| TPSA | 112.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.35 |
| LogP ≤ 5 | -2.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|