C24H24FN3S — CID 6088460
(Z)-4-(2-fluorophenyl)-N-(2-methylprop-2-enyl)-3-[(Z)-6,7,8,9-tetrahydrobenzo[7]annulen-5-ylideneamino]-1,3-thiazol-2-imine (PubChem CID 6088460) has the molecular formula C24H24FN3S and a molecular weight of 405.54 g/mol. Its IUPAC name is (Z)-4-(2-fluorophenyl)-N-(2-methylprop-2-enyl)-3-[(Z)-6,7,8,9-tetrahydrobenzo[7]annulen-5-ylideneamino]-1,3-thiazol-2-imine.
| Compound Name | (Z)-4-(2-fluorophenyl)-N-(2-methylprop-2-enyl)-3-[(Z)-6,7,8,9-tetrahydrobenzo[7]annulen-5-ylideneamino]-1,3-thiazol-2-imine |
|---|---|
| PubChem CID | 6088460 |
| Molecular Formula | C24H24FN3S |
| Molecular Weight | 405.54 g/mol |
| Exact Mass | 405.17 |
| IUPAC Name | (Z)-4-(2-fluorophenyl)-N-(2-methylprop-2-enyl)-3-[(Z)-6,7,8,9-tetrahydrobenzo[7]annulen-5-ylideneamino]-1,3-thiazol-2-imine |
| SMILES | C=C(C)C/N=c1\scc(-c2ccccc2F)n1/N=C1/CCCCc2ccccc21 |
| InChI | InChI=1S/C24H24FN3S/c1-17(2)15-26-24-28(23(16-29-24)20-12-6-7-13-21(20)25)27-22-14-8-4-10-18-9-3-5-11-19(18)22/h3,5-7,9,11-13,16H,1,4,8,10,14-15H2,2H3/b26-24-,27-22- |
| InChIKey | RUTGVLJIWVSKAY-QHNYZNEHSA-N |
| XLogP | 5.81 |
| TPSA | 29.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.54 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|