About 2-(4-hydroxy-1,1-dioxothiolan-3-yl)oxy-4-propoxybenzaldehyde
2-(4-hydroxy-1,1-dioxothiolan-3-yl)oxy-4-propoxybenzaldehyde (PubChem CID 60885507) has the molecular formula C14H18O6S
and a molecular weight of 314.36 g/mol. Its IUPAC name is 2-(4-hydroxy-1,1-dioxothiolan-3-yl)oxy-4-propoxybenzaldehyde.
Molecular Properties
| Compound Name | 2-(4-hydroxy-1,1-dioxothiolan-3-yl)oxy-4-propoxybenzaldehyde |
| PubChem CID | 60885507 |
| Molecular Formula | C14H18O6S |
| Molecular Weight | 314.36 g/mol |
| Exact Mass | 314.08 |
| IUPAC Name | 2-(4-hydroxy-1,1-dioxothiolan-3-yl)oxy-4-propoxybenzaldehyde |
| SMILES | CCCOc1ccc(C=O)c(OC2CS(=O)(=O)CC2O)c1 |
| InChI | InChI=1S/C14H18O6S/c1-2-5-19-11-4-3-10(7-15)13(6-11)20-14-9-21(17,18)8-12(14)16/h3-4,6-7,12,14,16H,2,5,8-9H2,1H3 |
| InChIKey | MBPQDZNMZHOTRW-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 314.36 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 2-(4-hydroxy-1,1-dioxothiolan-3-yl)oxy-4-propoxybenzaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-hydroxy-1,1-dioxothiolan-3-yl)oxy-4-propoxybenzaldehyde?
The IUPAC name of 2-(4-hydroxy-1,1-dioxothiolan-3-yl)oxy-4-propoxybenzaldehyde (CID 60885507) is 2-(4-hydroxy-1,1-dioxothiolan-3-yl)oxy-4-propoxybenzaldehyde.
What is the SMILES notation for 2-(4-hydroxy-1,1-dioxothiolan-3-yl)oxy-4-propoxybenzaldehyde?
The canonical SMILES for 2-(4-hydroxy-1,1-dioxothiolan-3-yl)oxy-4-propoxybenzaldehyde is CCCOc1ccc(C=O)c(OC2CS(=O)(=O)CC2O)c1.
What is the InChIKey of 2-(4-hydroxy-1,1-dioxothiolan-3-yl)oxy-4-propoxybenzaldehyde?
The InChIKey is MBPQDZNMZHOTRW-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H18O6S/c1-2-5-19-11-4-3-10(7-15)13(6-11)20-14-9-21(17,18)8-12(14)16/h3-4,6-7,12,14,16H,2,5,8-9H2,1H3.
What are the key properties of 2-(4-hydroxy-1,1-dioxothiolan-3-yl)oxy-4-propoxybenzaldehyde?
2-(4-hydroxy-1,1-dioxothiolan-3-yl)oxy-4-propoxybenzaldehyde has a molecular weight of 314.36 g/mol, XLogP of 0.82, 6 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-hydroxy-1,1-dioxothiolan-3-yl)oxy-4-propoxybenzaldehyde is sourced from PubChem (CID 60885507), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).