C10H13N3O2 — CID 60887002
2-(2-hydroxybutyl)-[1,2,4]triazolo[4,3-a]pyridin-3-one (PubChem CID 60887002) has the molecular formula C10H13N3O2 and a molecular weight of 207.23 g/mol. Its IUPAC name is 2-(2-hydroxybutyl)-[1,2,4]triazolo[4,3-a]pyridin-3-one.
| Compound Name | 2-(2-hydroxybutyl)-[1,2,4]triazolo[4,3-a]pyridin-3-one |
|---|---|
| PubChem CID | 60887002 |
| Molecular Formula | C10H13N3O2 |
| Molecular Weight | 207.23 g/mol |
| Exact Mass | 207.10 |
| IUPAC Name | 2-(2-hydroxybutyl)-[1,2,4]triazolo[4,3-a]pyridin-3-one |
| SMILES | CCC(O)Cn1nc2ccccn2c1=O |
| InChI | InChI=1S/C10H13N3O2/c1-2-8(14)7-13-10(15)12-6-4-3-5-9(12)11-13/h3-6,8,14H,2,7H2,1H3 |
| InChIKey | BRNXMYXSWOGDKT-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 59.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.23 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |