C15H22FNS — CID 60887037
1-(2-cyclohexylsulfanyl-6-fluorophenyl)-N-methylethanamine (PubChem CID 60887037) has the molecular formula C15H22FNS and a molecular weight of 267.41 g/mol. Its IUPAC name is 1-(2-cyclohexylsulfanyl-6-fluorophenyl)-N-methylethanamine.
| Compound Name | 1-(2-cyclohexylsulfanyl-6-fluorophenyl)-N-methylethanamine |
|---|---|
| PubChem CID | 60887037 |
| Molecular Formula | C15H22FNS |
| Molecular Weight | 267.41 g/mol |
| Exact Mass | 267.15 |
| IUPAC Name | 1-(2-cyclohexylsulfanyl-6-fluorophenyl)-N-methylethanamine |
| SMILES | CNC(C)c1c(F)cccc1SC1CCCCC1 |
| InChI | InChI=1S/C15H22FNS/c1-11(17-2)15-13(16)9-6-10-14(15)18-12-7-4-3-5-8-12/h6,9-12,17H,3-5,7-8H2,1-2H3 |
| InChIKey | VRBXRDUCEUNAEQ-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.41 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |