C28H40N2 — CID 608871
2-N,3-N-bis[2,6-di(propan-2-yl)phenyl]butane-2,3-diimine (PubChem CID 608871) has the molecular formula C28H40N2 and a molecular weight of 404.64 g/mol. Its IUPAC name is 2-N,3-N-bis[2,6-di(propan-2-yl)phenyl]butane-2,3-diimine.
| Compound Name | 2-N,3-N-bis[2,6-di(propan-2-yl)phenyl]butane-2,3-diimine |
|---|---|
| PubChem CID | 608871 |
| Molecular Formula | C28H40N2 |
| Molecular Weight | 404.64 g/mol |
| Exact Mass | 404.32 |
| IUPAC Name | 2-N,3-N-bis[2,6-di(propan-2-yl)phenyl]butane-2,3-diimine |
| SMILES | CC(=N\c1c(C(C)C)cccc1C(C)C)/C(C)=N/c1c(C(C)C)cccc1C(C)C |
| InChI | InChI=1S/C28H40N2/c1-17(2)23-13-11-14-24(18(3)4)27(23)29-21(9)22(10)30-28-25(19(5)6)15-12-16-26(28)20(7)8/h11-20H,1-10H3/b29-21+,30-22+ |
| InChIKey | YUFQUBWPYIPRHZ-VFIVCBTMSA-N |
| XLogP | 9.07 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.64 |
| LogP ≤ 5 | 9.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|