C13H18N2O — CID 60888739
N'-[(2-ethyl-1-benzofuran-3-yl)methyl]ethane-1,2-diamine (PubChem CID 60888739) has the molecular formula C13H18N2O and a molecular weight of 218.30 g/mol. Its IUPAC name is N'-[(2-ethyl-1-benzofuran-3-yl)methyl]ethane-1,2-diamine.
| Compound Name | N'-[(2-ethyl-1-benzofuran-3-yl)methyl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 60888739 |
| Molecular Formula | C13H18N2O |
| Molecular Weight | 218.30 g/mol |
| Exact Mass | 218.14 |
| IUPAC Name | N'-[(2-ethyl-1-benzofuran-3-yl)methyl]ethane-1,2-diamine |
| SMILES | CCc1oc2ccccc2c1CNCCN |
| InChI | InChI=1S/C13H18N2O/c1-2-12-11(9-15-8-7-14)10-5-3-4-6-13(10)16-12/h3-6,15H,2,7-9,14H2,1H3 |
| InChIKey | MIMYQCIMYPLMIP-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 51.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.30 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|