C16H17NO — CID 60889205
1-(1-but-3-ynoxynaphthalen-2-yl)ethanamine (PubChem CID 60889205) has the molecular formula C16H17NO and a molecular weight of 239.32 g/mol. Its IUPAC name is 1-(1-but-3-ynoxynaphthalen-2-yl)ethanamine.
| Compound Name | 1-(1-but-3-ynoxynaphthalen-2-yl)ethanamine |
|---|---|
| PubChem CID | 60889205 |
| Molecular Formula | C16H17NO |
| Molecular Weight | 239.32 g/mol |
| Exact Mass | 239.13 |
| IUPAC Name | 1-(1-but-3-ynoxynaphthalen-2-yl)ethanamine |
| SMILES | C#CCCOc1c(C(C)N)ccc2ccccc12 |
| InChI | InChI=1S/C16H17NO/c1-3-4-11-18-16-14(12(2)17)10-9-13-7-5-6-8-15(13)16/h1,5-10,12H,4,11,17H2,2H3 |
| InChIKey | DIKXVRKRQIURHJ-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.32 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|