C14H18BrNO4 — CID 60889471
3-[2-bromo-6-ethoxy-4-(methylaminomethyl)phenoxy]oxolan-2-one (PubChem CID 60889471) has the molecular formula C14H18BrNO4 and a molecular weight of 344.21 g/mol. Its IUPAC name is 3-[2-bromo-6-ethoxy-4-(methylaminomethyl)phenoxy]oxolan-2-one.
| Compound Name | 3-[2-bromo-6-ethoxy-4-(methylaminomethyl)phenoxy]oxolan-2-one |
|---|---|
| PubChem CID | 60889471 |
| Molecular Formula | C14H18BrNO4 |
| Molecular Weight | 344.21 g/mol |
| Exact Mass | 343.04 |
| IUPAC Name | 3-[2-bromo-6-ethoxy-4-(methylaminomethyl)phenoxy]oxolan-2-one |
| SMILES | CCOc1cc(CNC)cc(Br)c1OC1CCOC1=O |
| InChI | InChI=1S/C14H18BrNO4/c1-3-18-12-7-9(8-16-2)6-10(15)13(12)20-11-4-5-19-14(11)17/h6-7,11,16H,3-5,8H2,1-2H3 |
| InChIKey | LHNZKXPBMOJXNF-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.21 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |