C11H17F3N4S — CID 60890454
4-cyclohexyl-3-[methyl(2,2,2-trifluoroethyl)amino]-1H-1,2,4-triazole-5-thione (PubChem CID 60890454) has the molecular formula C11H17F3N4S and a molecular weight of 294.35 g/mol. Its IUPAC name is 4-cyclohexyl-3-[methyl(2,2,2-trifluoroethyl)amino]-1H-1,2,4-triazole-5-thione.
| Compound Name | 4-cyclohexyl-3-[methyl(2,2,2-trifluoroethyl)amino]-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 60890454 |
| Molecular Formula | C11H17F3N4S |
| Molecular Weight | 294.35 g/mol |
| Exact Mass | 294.11 |
| IUPAC Name | 4-cyclohexyl-3-[methyl(2,2,2-trifluoroethyl)amino]-1H-1,2,4-triazole-5-thione |
| SMILES | CN(CC(F)(F)F)c1n[nH]c(=S)n1C1CCCCC1 |
| InChI | InChI=1S/C11H17F3N4S/c1-17(7-11(12,13)14)9-15-16-10(19)18(9)8-5-3-2-4-6-8/h8H,2-7H2,1H3,(H,16,19) |
| InChIKey | JLJNDEPLYDVDDF-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 36.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.35 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|