C10H12F3N5O2S — CID 60890456
2-hydrazinyl-N-methyl-N-(2,2,2-trifluoroethyl)imidazo[1,2-a]pyridine-3-sulfonamide (PubChem CID 60890456) has the molecular formula C10H12F3N5O2S and a molecular weight of 323.30 g/mol. Its IUPAC name is 2-hydrazinyl-N-methyl-N-(2,2,2-trifluoroethyl)imidazo[1,2-a]pyridine-3-sulfonamide.
| Compound Name | 2-hydrazinyl-N-methyl-N-(2,2,2-trifluoroethyl)imidazo[1,2-a]pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 60890456 |
| Molecular Formula | C10H12F3N5O2S |
| Molecular Weight | 323.30 g/mol |
| Exact Mass | 323.07 |
| IUPAC Name | 2-hydrazinyl-N-methyl-N-(2,2,2-trifluoroethyl)imidazo[1,2-a]pyridine-3-sulfonamide |
| SMILES | CN(CC(F)(F)F)S(=O)(=O)c1c(NN)nc2ccccn12 |
| InChI | InChI=1S/C10H12F3N5O2S/c1-17(6-10(11,12)13)21(19,20)9-8(16-14)15-7-4-2-3-5-18(7)9/h2-5,16H,6,14H2,1H3 |
| InChIKey | KGJLQQYNZCLECR-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 92.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.30 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|