About N-methyl-6-oxo-N-(2,2,2-trifluoroethyl)-1H-pyridine-3-sulfonamide
N-methyl-6-oxo-N-(2,2,2-trifluoroethyl)-1H-pyridine-3-sulfonamide (PubChem CID 60890469) has the molecular formula C8H9F3N2O3S
and a molecular weight of 270.23 g/mol. Its IUPAC name is N-methyl-6-oxo-N-(2,2,2-trifluoroethyl)-1H-pyridine-3-sulfonamide.
Molecular Properties
| Compound Name | N-methyl-6-oxo-N-(2,2,2-trifluoroethyl)-1H-pyridine-3-sulfonamide |
| PubChem CID | 60890469 |
| Molecular Formula | C8H9F3N2O3S |
| Molecular Weight | 270.23 g/mol |
| Exact Mass | 270.03 |
| IUPAC Name | N-methyl-6-oxo-N-(2,2,2-trifluoroethyl)-1H-pyridine-3-sulfonamide |
| SMILES | CN(CC(F)(F)F)S(=O)(=O)c1ccc(=O)[nH]c1 |
| InChI | InChI=1S/C8H9F3N2O3S/c1-13(5-8(9,10)11)17(15,16)6-2-3-7(14)12-4-6/h2-4H,5H2,1H3,(H,12,14) |
| InChIKey | HJLBWOHBSDKCDS-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 70.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.23 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-methyl-6-oxo-N-(2,2,2-trifluoroethyl)-1H-pyridine-3-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methyl-6-oxo-N-(2,2,2-trifluoroethyl)-1H-pyridine-3-sulfonamide?
The IUPAC name of N-methyl-6-oxo-N-(2,2,2-trifluoroethyl)-1H-pyridine-3-sulfonamide (CID 60890469) is N-methyl-6-oxo-N-(2,2,2-trifluoroethyl)-1H-pyridine-3-sulfonamide.
What is the SMILES notation for N-methyl-6-oxo-N-(2,2,2-trifluoroethyl)-1H-pyridine-3-sulfonamide?
The canonical SMILES for N-methyl-6-oxo-N-(2,2,2-trifluoroethyl)-1H-pyridine-3-sulfonamide is CN(CC(F)(F)F)S(=O)(=O)c1ccc(=O)[nH]c1.
What is the InChIKey of N-methyl-6-oxo-N-(2,2,2-trifluoroethyl)-1H-pyridine-3-sulfonamide?
The InChIKey is HJLBWOHBSDKCDS-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9F3N2O3S/c1-13(5-8(9,10)11)17(15,16)6-2-3-7(14)12-4-6/h2-4H,5H2,1H3,(H,12,14).
What are the key properties of N-methyl-6-oxo-N-(2,2,2-trifluoroethyl)-1H-pyridine-3-sulfonamide?
N-methyl-6-oxo-N-(2,2,2-trifluoroethyl)-1H-pyridine-3-sulfonamide has a molecular weight of 270.23 g/mol, XLogP of 0.56, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-methyl-6-oxo-N-(2,2,2-trifluoroethyl)-1H-pyridine-3-sulfonamide is sourced from PubChem (CID 60890469), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).