C11H13ClF3NO2S — CID 60890472
4-(2-chloroethyl)-N-methyl-N-(2,2,2-trifluoroethyl)benzenesulfonamide (PubChem CID 60890472) has the molecular formula C11H13ClF3NO2S and a molecular weight of 315.74 g/mol. Its IUPAC name is 4-(2-chloroethyl)-N-methyl-N-(2,2,2-trifluoroethyl)benzenesulfonamide.
| Compound Name | 4-(2-chloroethyl)-N-methyl-N-(2,2,2-trifluoroethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 60890472 |
| Molecular Formula | C11H13ClF3NO2S |
| Molecular Weight | 315.74 g/mol |
| Exact Mass | 315.03 |
| IUPAC Name | 4-(2-chloroethyl)-N-methyl-N-(2,2,2-trifluoroethyl)benzenesulfonamide |
| SMILES | CN(CC(F)(F)F)S(=O)(=O)c1ccc(CCCl)cc1 |
| InChI | InChI=1S/C11H13ClF3NO2S/c1-16(8-11(13,14)15)19(17,18)10-4-2-9(3-5-10)6-7-12/h2-5H,6-8H2,1H3 |
| InChIKey | CTEQIVSCGFDHLK-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.74 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|