C13H17F3N2 — CID 60890603
2-N-methyl-2-N-(2,2,2-trifluoroethyl)-1,2,3,4-tetrahydronaphthalene-1,2-diamine (PubChem CID 60890603) has the molecular formula C13H17F3N2 and a molecular weight of 258.29 g/mol. Its IUPAC name is 2-N-methyl-2-N-(2,2,2-trifluoroethyl)-1,2,3,4-tetrahydronaphthalene-1,2-diamine.
| Compound Name | 2-N-methyl-2-N-(2,2,2-trifluoroethyl)-1,2,3,4-tetrahydronaphthalene-1,2-diamine |
|---|---|
| PubChem CID | 60890603 |
| Molecular Formula | C13H17F3N2 |
| Molecular Weight | 258.29 g/mol |
| Exact Mass | 258.13 |
| IUPAC Name | 2-N-methyl-2-N-(2,2,2-trifluoroethyl)-1,2,3,4-tetrahydronaphthalene-1,2-diamine |
| SMILES | CN(CC(F)(F)F)C1CCc2ccccc2C1N |
| InChI | InChI=1S/C13H17F3N2/c1-18(8-13(14,15)16)11-7-6-9-4-2-3-5-10(9)12(11)17/h2-5,11-12H,6-8,17H2,1H3 |
| InChIKey | XKKAIILFFRJMDO-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.29 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |