About 4-tert-butyl-2-[methyl(2,2,2-trifluoroethyl)amino]cyclohexane-1-carbonitrile
4-tert-butyl-2-[methyl(2,2,2-trifluoroethyl)amino]cyclohexane-1-carbonitrile (PubChem CID 60890612) has the molecular formula C14H23F3N2
and a molecular weight of 276.35 g/mol. Its IUPAC name is 4-tert-butyl-2-[methyl(2,2,2-trifluoroethyl)amino]cyclohexane-1-carbonitrile.
Molecular Properties
| Compound Name | 4-tert-butyl-2-[methyl(2,2,2-trifluoroethyl)amino]cyclohexane-1-carbonitrile |
| PubChem CID | 60890612 |
| Molecular Formula | C14H23F3N2 |
| Molecular Weight | 276.35 g/mol |
| Exact Mass | 276.18 |
| IUPAC Name | 4-tert-butyl-2-[methyl(2,2,2-trifluoroethyl)amino]cyclohexane-1-carbonitrile |
| SMILES | CN(CC(F)(F)F)C1CC(C(C)(C)C)CCC1C#N |
| InChI | InChI=1S/C14H23F3N2/c1-13(2,3)11-6-5-10(8-18)12(7-11)19(4)9-14(15,16)17/h10-12H,5-7,9H2,1-4H3 |
| InChIKey | PYBWNEODLFFVNG-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 27.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.35 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-tert-butyl-2-[methyl(2,2,2-trifluoroethyl)amino]cyclohexane-1-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-tert-butyl-2-[methyl(2,2,2-trifluoroethyl)amino]cyclohexane-1-carbonitrile?
The IUPAC name of 4-tert-butyl-2-[methyl(2,2,2-trifluoroethyl)amino]cyclohexane-1-carbonitrile (CID 60890612) is 4-tert-butyl-2-[methyl(2,2,2-trifluoroethyl)amino]cyclohexane-1-carbonitrile.
What is the SMILES notation for 4-tert-butyl-2-[methyl(2,2,2-trifluoroethyl)amino]cyclohexane-1-carbonitrile?
The canonical SMILES for 4-tert-butyl-2-[methyl(2,2,2-trifluoroethyl)amino]cyclohexane-1-carbonitrile is CN(CC(F)(F)F)C1CC(C(C)(C)C)CCC1C#N.
What is the InChIKey of 4-tert-butyl-2-[methyl(2,2,2-trifluoroethyl)amino]cyclohexane-1-carbonitrile?
The InChIKey is PYBWNEODLFFVNG-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H23F3N2/c1-13(2,3)11-6-5-10(8-18)12(7-11)19(4)9-14(15,16)17/h10-12H,5-7,9H2,1-4H3.
What are the key properties of 4-tert-butyl-2-[methyl(2,2,2-trifluoroethyl)amino]cyclohexane-1-carbonitrile?
4-tert-butyl-2-[methyl(2,2,2-trifluoroethyl)amino]cyclohexane-1-carbonitrile has a molecular weight of 276.35 g/mol, XLogP of 3.84, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-tert-butyl-2-[methyl(2,2,2-trifluoroethyl)amino]cyclohexane-1-carbonitrile is sourced from PubChem (CID 60890612), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).