C9H12F3N3O — CID 60890811
1,3-dimethyl-5-[methyl(2,2,2-trifluoroethyl)amino]pyrazole-4-carbaldehyde (PubChem CID 60890811) has the molecular formula C9H12F3N3O and a molecular weight of 235.21 g/mol. Its IUPAC name is 1,3-dimethyl-5-[methyl(2,2,2-trifluoroethyl)amino]pyrazole-4-carbaldehyde.
| Compound Name | 1,3-dimethyl-5-[methyl(2,2,2-trifluoroethyl)amino]pyrazole-4-carbaldehyde |
|---|---|
| PubChem CID | 60890811 |
| Molecular Formula | C9H12F3N3O |
| Molecular Weight | 235.21 g/mol |
| Exact Mass | 235.09 |
| IUPAC Name | 1,3-dimethyl-5-[methyl(2,2,2-trifluoroethyl)amino]pyrazole-4-carbaldehyde |
| SMILES | Cc1nn(C)c(N(C)CC(F)(F)F)c1C=O |
| InChI | InChI=1S/C9H12F3N3O/c1-6-7(4-16)8(15(3)13-6)14(2)5-9(10,11)12/h4H,5H2,1-3H3 |
| InChIKey | LNRPFDMWUHUZGO-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.21 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|