C9H10ClF3N2OS — CID 60890841
2-[4-(chloromethyl)-1,3-thiazol-2-yl]-N-methyl-N-(2,2,2-trifluoroethyl)acetamide (PubChem CID 60890841) has the molecular formula C9H10ClF3N2OS and a molecular weight of 286.71 g/mol. Its IUPAC name is 2-[4-(chloromethyl)-1,3-thiazol-2-yl]-N-methyl-N-(2,2,2-trifluoroethyl)acetamide.
| Compound Name | 2-[4-(chloromethyl)-1,3-thiazol-2-yl]-N-methyl-N-(2,2,2-trifluoroethyl)acetamide |
|---|---|
| PubChem CID | 60890841 |
| Molecular Formula | C9H10ClF3N2OS |
| Molecular Weight | 286.71 g/mol |
| Exact Mass | 286.02 |
| IUPAC Name | 2-[4-(chloromethyl)-1,3-thiazol-2-yl]-N-methyl-N-(2,2,2-trifluoroethyl)acetamide |
| SMILES | CN(CC(F)(F)F)C(=O)Cc1nc(CCl)cs1 |
| InChI | InChI=1S/C9H10ClF3N2OS/c1-15(5-9(11,12)13)8(16)2-7-14-6(3-10)4-17-7/h4H,2-3,5H2,1H3 |
| InChIKey | GKAOBXHTNARZNR-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.71 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|