C9H11F3N4 — CID 60891190
2-[methyl(2,2,2-trifluoroethyl)amino]pyridine-4-carboximidamide (PubChem CID 60891190) has the molecular formula C9H11F3N4 and a molecular weight of 232.21 g/mol. Its IUPAC name is 2-[methyl(2,2,2-trifluoroethyl)amino]pyridine-4-carboximidamide.
| Compound Name | 2-[methyl(2,2,2-trifluoroethyl)amino]pyridine-4-carboximidamide |
|---|---|
| PubChem CID | 60891190 |
| Molecular Formula | C9H11F3N4 |
| Molecular Weight | 232.21 g/mol |
| Exact Mass | 232.09 |
| IUPAC Name | 2-[methyl(2,2,2-trifluoroethyl)amino]pyridine-4-carboximidamide |
| SMILES | [H]/N=C(\N)c1ccnc(N(C)CC(F)(F)F)c1 |
| InChI | InChI=1S/C9H11F3N4/c1-16(5-9(10,11)12)7-4-6(8(13)14)2-3-15-7/h2-4H,5H2,1H3,(H3,13,14) |
| InChIKey | LBQPQHKYKJTKOF-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 66.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.21 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|