About 4-[methyl(2,2,2-trifluoroethyl)amino]butanimidamide
4-[methyl(2,2,2-trifluoroethyl)amino]butanimidamide (PubChem CID 60891752) has the molecular formula C7H14F3N3
and a molecular weight of 197.20 g/mol. Its IUPAC name is 4-[methyl(2,2,2-trifluoroethyl)amino]butanimidamide.
Molecular Properties
| Compound Name | 4-[methyl(2,2,2-trifluoroethyl)amino]butanimidamide |
| PubChem CID | 60891752 |
| Molecular Formula | C7H14F3N3 |
| Molecular Weight | 197.20 g/mol |
| Exact Mass | 197.11 |
| IUPAC Name | 4-[methyl(2,2,2-trifluoroethyl)amino]butanimidamide |
| SMILES | [H]/N=C(\N)CCCN(C)CC(F)(F)F |
| InChI | InChI=1S/C7H14F3N3/c1-13(5-7(8,9)10)4-2-3-6(11)12/h2-5H2,1H3,(H3,11,12) |
| InChIKey | XXNXAMBGZZUKJA-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 53.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.20 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 4-[methyl(2,2,2-trifluoroethyl)amino]butanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[methyl(2,2,2-trifluoroethyl)amino]butanimidamide?
The IUPAC name of 4-[methyl(2,2,2-trifluoroethyl)amino]butanimidamide (CID 60891752) is 4-[methyl(2,2,2-trifluoroethyl)amino]butanimidamide.
What is the SMILES notation for 4-[methyl(2,2,2-trifluoroethyl)amino]butanimidamide?
The canonical SMILES for 4-[methyl(2,2,2-trifluoroethyl)amino]butanimidamide is [H]/N=C(\N)CCCN(C)CC(F)(F)F.
What is the InChIKey of 4-[methyl(2,2,2-trifluoroethyl)amino]butanimidamide?
The InChIKey is XXNXAMBGZZUKJA-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H14F3N3/c1-13(5-7(8,9)10)4-2-3-6(11)12/h2-5H2,1H3,(H3,11,12).
What are the key properties of 4-[methyl(2,2,2-trifluoroethyl)amino]butanimidamide?
4-[methyl(2,2,2-trifluoroethyl)amino]butanimidamide has a molecular weight of 197.20 g/mol, XLogP of 1.20, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[methyl(2,2,2-trifluoroethyl)amino]butanimidamide is sourced from PubChem (CID 60891752), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).