C7H14F3N3O2S — CID 60891761
N-methyl-N-(2,2,2-trifluoroethyl)piperazine-1-sulfonamide (PubChem CID 60891761) has the molecular formula C7H14F3N3O2S and a molecular weight of 261.27 g/mol. Its IUPAC name is N-methyl-N-(2,2,2-trifluoroethyl)piperazine-1-sulfonamide.
| Compound Name | N-methyl-N-(2,2,2-trifluoroethyl)piperazine-1-sulfonamide |
|---|---|
| PubChem CID | 60891761 |
| Molecular Formula | C7H14F3N3O2S |
| Molecular Weight | 261.27 g/mol |
| Exact Mass | 261.08 |
| IUPAC Name | N-methyl-N-(2,2,2-trifluoroethyl)piperazine-1-sulfonamide |
| SMILES | CN(CC(F)(F)F)S(=O)(=O)N1CCNCC1 |
| InChI | InChI=1S/C7H14F3N3O2S/c1-12(6-7(8,9)10)16(14,15)13-4-2-11-3-5-13/h11H,2-6H2,1H3 |
| InChIKey | DXZWIQASSMKSOS-UHFFFAOYSA-N |
| XLogP | -0.37 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.27 |
| LogP ≤ 5 | -0.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |