C9H9Br2F3N2O2S — CID 60891921
4-amino-2,6-dibromo-N-methyl-N-(2,2,2-trifluoroethyl)benzenesulfonamide (PubChem CID 60891921) has the molecular formula C9H9Br2F3N2O2S and a molecular weight of 426.05 g/mol. Its IUPAC name is 4-amino-2,6-dibromo-N-methyl-N-(2,2,2-trifluoroethyl)benzenesulfonamide.
| Compound Name | 4-amino-2,6-dibromo-N-methyl-N-(2,2,2-trifluoroethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 60891921 |
| Molecular Formula | C9H9Br2F3N2O2S |
| Molecular Weight | 426.05 g/mol |
| Exact Mass | 423.87 |
| IUPAC Name | 4-amino-2,6-dibromo-N-methyl-N-(2,2,2-trifluoroethyl)benzenesulfonamide |
| SMILES | CN(CC(F)(F)F)S(=O)(=O)c1c(Br)cc(N)cc1Br |
| InChI | InChI=1S/C9H9Br2F3N2O2S/c1-16(4-9(12,13)14)19(17,18)8-6(10)2-5(15)3-7(8)11/h2-3H,4,15H2,1H3 |
| InChIKey | OVYYPGZRBTWYIW-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.05 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|